C23H26ClN5O2 — CID 162670039
3-[(3E)-3-[2-(piperidin-4-ylamino)ethoxyimino]indol-2-yl]-1H-indol-2-ol;hydrochloride (PubChem CID 162670039) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 3-[(3E)-3-[2-(piperidin-4-ylamino)ethoxyimino]indol-2-yl]-1H-indol-2-ol;hydrochloride.
| Compound Name | 3-[(3E)-3-[2-(piperidin-4-ylamino)ethoxyimino]indol-2-yl]-1H-indol-2-ol;hydrochloride |
|---|---|
| PubChem CID | 162670039 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[(3E)-3-[2-(piperidin-4-ylamino)ethoxyimino]indol-2-yl]-1H-indol-2-ol;hydrochloride |
| SMILES | Cl.Oc1[nH]c2ccccc2c1C1=Nc2ccccc2/C1=N\OCCNC1CCNCC1 |
| InChI | InChI=1S/C23H25N5O2.ClH/c29-23-20(16-5-1-3-7-18(16)27-23)22-21(17-6-2-4-8-19(17)26-22)28-30-14-13-25-15-9-11-24-12-10-15;/h1-8,15,24-25,27,29H,9-14H2;1H/b28-21+; |
| InChIKey | ABDZSVZUCJWVMU-HUPDFLJJSA-N |
| XLogP | 3.49 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|