C22H23BrN4O3 — CID 172952138
5-bromo-3-[(3E)-3-[2-[2-hydroxypropyl(methyl)amino]ethoxyimino]indol-2-yl]-1H-indol-2-ol (PubChem CID 172952138) has the molecular formula C22H23BrN4O3 and a molecular weight of 471.36 g/mol. Its IUPAC name is 5-bromo-3-[(3E)-3-[2-[2-hydroxypropyl(methyl)amino]ethoxyimino]indol-2-yl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[(3E)-3-[2-[2-hydroxypropyl(methyl)amino]ethoxyimino]indol-2-yl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 172952138 |
| Molecular Formula | C22H23BrN4O3 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 5-bromo-3-[(3E)-3-[2-[2-hydroxypropyl(methyl)amino]ethoxyimino]indol-2-yl]-1H-indol-2-ol |
| SMILES | CC(O)CN(C)CCO/N=C1/C(c2c(O)[nH]c3ccc(Br)cc23)=Nc2ccccc21 |
| InChI | InChI=1S/C22H23BrN4O3/c1-13(28)12-27(2)9-10-30-26-20-15-5-3-4-6-17(15)24-21(20)19-16-11-14(23)7-8-18(16)25-22(19)29/h3-8,11,13,25,28-29H,9-10,12H2,1-2H3/b26-20+ |
| InChIKey | PXUNSKGANYCZCJ-LHLOQNFPSA-N |
| XLogP | 3.80 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|