C20H16BrN3O4 — CID 142579235
methyl 3-[(3E)-3-(2-bromoethoxyimino)indol-2-yl]-2-hydroxy-1H-indole-5-carboxylate (PubChem CID 142579235) has the molecular formula C20H16BrN3O4 and a molecular weight of 442.27 g/mol. Its IUPAC name is methyl 3-[(3E)-3-(2-bromoethoxyimino)indol-2-yl]-2-hydroxy-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[(3E)-3-(2-bromoethoxyimino)indol-2-yl]-2-hydroxy-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 142579235 |
| Molecular Formula | C20H16BrN3O4 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | methyl 3-[(3E)-3-(2-bromoethoxyimino)indol-2-yl]-2-hydroxy-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c(O)c(C3=Nc4ccccc4/C3=N\OCCBr)c2c1 |
| InChI | InChI=1S/C20H16BrN3O4/c1-27-20(26)11-6-7-15-13(10-11)16(19(25)23-15)18-17(24-28-9-8-21)12-4-2-3-5-14(12)22-18/h2-7,10,23,25H,8-9H2,1H3/b24-17+ |
| InChIKey | FYYNCMZQNXOQKJ-JJIBRWJFSA-N |
| XLogP | 3.91 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|