C18H11BrN4O5 — CID 135431642
[(E)-[2-(6-bromo-2-hydroxy-5-nitro-1H-indol-3-yl)indol-3-ylidene]amino] acetate (PubChem CID 135431642) has the molecular formula C18H11BrN4O5 and a molecular weight of 443.21 g/mol. Its IUPAC name is [(E)-[2-(6-bromo-2-hydroxy-5-nitro-1H-indol-3-yl)indol-3-ylidene]amino] acetate.
| Compound Name | [(E)-[2-(6-bromo-2-hydroxy-5-nitro-1H-indol-3-yl)indol-3-ylidene]amino] acetate |
|---|---|
| PubChem CID | 135431642 |
| Molecular Formula | C18H11BrN4O5 |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | [(E)-[2-(6-bromo-2-hydroxy-5-nitro-1H-indol-3-yl)indol-3-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C1/C(c2c(O)[nH]c3cc(Br)c([N+](=O)[O-])cc23)=Nc2ccccc21 |
| InChI | InChI=1S/C18H11BrN4O5/c1-8(24)28-22-16-9-4-2-3-5-12(9)20-17(16)15-10-6-14(23(26)27)11(19)7-13(10)21-18(15)25/h2-7,21,25H,1H3/b22-16+ |
| InChIKey | KNJDUDNAWDSIMB-CJLVFECKSA-N |
| XLogP | 3.95 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|