C18H15N5O5 — CID 162661553
(3E)-3-(2-aminoethoxyimino)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)indol-5-ol (PubChem CID 162661553) has the molecular formula C18H15N5O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is (3E)-3-(2-aminoethoxyimino)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)indol-5-ol.
| Compound Name | (3E)-3-(2-aminoethoxyimino)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)indol-5-ol |
|---|---|
| PubChem CID | 162661553 |
| Molecular Formula | C18H15N5O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (3E)-3-(2-aminoethoxyimino)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)indol-5-ol |
| SMILES | NCCO/N=C1/C(c2c(O)[nH]c3ccc([N+](=O)[O-])cc23)=Nc2ccc(O)cc21 |
| InChI | InChI=1S/C18H15N5O5/c19-5-6-28-22-16-12-8-10(24)2-4-14(12)20-17(16)15-11-7-9(23(26)27)1-3-13(11)21-18(15)25/h1-4,7-8,21,24-25H,5-6,19H2/b22-16+ |
| InChIKey | XNZNOSVRBXIJSU-CJLVFECKSA-N |
| XLogP | 2.30 |
| TPSA | 159.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|