C23H20FN5O3 — CID 170658214
1-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-[(E)-[2-(5-fluoro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethanone (PubChem CID 170658214) has the molecular formula C23H20FN5O3 and a molecular weight of 433.44 g/mol. Its IUPAC name is 1-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-[(E)-[2-(5-fluoro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethanone.
| Compound Name | 1-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-[(E)-[2-(5-fluoro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethanone |
|---|---|
| PubChem CID | 170658214 |
| Molecular Formula | C23H20FN5O3 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-[(E)-[2-(5-fluoro-2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethanone |
| SMILES | O=C(CO/N=C1/C(c2c(O)[nH]c3ccc(F)cc23)=Nc2ccccc21)N1C[C@@H]2C[C@H]1CN2 |
| InChI | InChI=1S/C23H20FN5O3/c24-12-5-6-18-16(7-12)20(23(31)27-18)22-21(15-3-1-2-4-17(15)26-22)28-32-11-19(30)29-10-13-8-14(29)9-25-13/h1-7,13-14,25,27,31H,8-11H2/b28-21+/t13-,14-/m0/s1 |
| InChIKey | FOLGYKXNLVMISS-VYDWPTSZSA-N |
| XLogP | 2.44 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|