C24H25N3O8 — CID 135544152
(3R,4S,5R,6R)-2-[2-[(E)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 135544152) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[2-[(E)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5R,6R)-2-[2-[(E)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 135544152 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (3R,4S,5R,6R)-2-[2-[(E)-[2-(2-hydroxy-1H-indol-3-yl)indol-3-ylidene]amino]oxyethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(OCCO/N=C2/C(c3c(O)[nH]c4ccccc34)=Nc3ccccc32)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H25N3O8/c28-11-16-20(29)21(30)22(31)24(35-16)33-9-10-34-27-18-13-6-2-4-8-15(13)25-19(18)17-12-5-1-3-7-14(12)26-23(17)32/h1-8,16,20-22,24,26,28-32H,9-11H2/b27-18+/t16-,20+,21+,22-,24?/m1/s1 |
| InChIKey | RYUOAQSYRBKSLR-PNOJMAERSA-N |
| XLogP | 0.55 |
| TPSA | 169.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|