C22H22F3NO5S — CID 162665559
butyl 2-[7-methyl-1,1-dioxo-2-[3-(trifluoromethyl)benzoyl]-3H-1,2-benzothiazol-3-yl]acetate (PubChem CID 162665559) has the molecular formula C22H22F3NO5S and a molecular weight of 469.48 g/mol. Its IUPAC name is butyl 2-[7-methyl-1,1-dioxo-2-[3-(trifluoromethyl)benzoyl]-3H-1,2-benzothiazol-3-yl]acetate.
| Compound Name | butyl 2-[7-methyl-1,1-dioxo-2-[3-(trifluoromethyl)benzoyl]-3H-1,2-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 162665559 |
| Molecular Formula | C22H22F3NO5S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | butyl 2-[7-methyl-1,1-dioxo-2-[3-(trifluoromethyl)benzoyl]-3H-1,2-benzothiazol-3-yl]acetate |
| SMILES | CCCCOC(=O)CC1c2cccc(C)c2S(=O)(=O)N1C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F3NO5S/c1-3-4-11-31-19(27)13-18-17-10-5-7-14(2)20(17)32(29,30)26(18)21(28)15-8-6-9-16(12-15)22(23,24)25/h5-10,12,18H,3-4,11,13H2,1-2H3 |
| InChIKey | MFWBVBRRAIRXKN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|