C15H9ClN4O5S — CID 162666397
8-chloro-2-[(3,5-dinitrophenyl)methylsulfanyl]-3H-quinazolin-4-one (PubChem CID 162666397) has the molecular formula C15H9ClN4O5S and a molecular weight of 392.78 g/mol. Its IUPAC name is 8-chloro-2-[(3,5-dinitrophenyl)methylsulfanyl]-3H-quinazolin-4-one.
| Compound Name | 8-chloro-2-[(3,5-dinitrophenyl)methylsulfanyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 162666397 |
| Molecular Formula | C15H9ClN4O5S |
| Molecular Weight | 392.78 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 8-chloro-2-[(3,5-dinitrophenyl)methylsulfanyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(SCc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C15H9ClN4O5S/c16-12-3-1-2-11-13(12)17-15(18-14(11)21)26-7-8-4-9(19(22)23)6-10(5-8)20(24)25/h1-6H,7H2,(H,17,18,21) |
| InChIKey | DRVCIIPHQKSJIR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|