C33H32FNO3 — CID 162666840
(3S)-3-[2-fluoro-4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 162666840) has the molecular formula C33H32FNO3 and a molecular weight of 509.62 g/mol. Its IUPAC name is (3S)-3-[2-fluoro-4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[2-fluoro-4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 162666840 |
| Molecular Formula | C33H32FNO3 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | (3S)-3-[2-fluoro-4-[[4-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@H](CC(=O)O)c1ccc(OCc2ccc(CN3CCC4(C=Cc5ccccc54)CC3)cc2)cc1F |
| InChI | InChI=1S/C33H32FNO3/c1-2-5-27(20-32(36)37)29-13-12-28(21-31(29)34)38-23-25-10-8-24(9-11-25)22-35-18-16-33(17-19-35)15-14-26-6-3-4-7-30(26)33/h3-4,6-15,21,27H,16-20,22-23H2,1H3,(H,36,37)/t27-/m1/s1 |
| InChIKey | NEGIWTYBODMDQN-HHHXNRCGSA-N |
| XLogP | 6.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|