C33H36N2O3 — CID 51357276
(3S)-3-[4-[[4-[(1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 51357276) has the molecular formula C33H36N2O3 and a molecular weight of 508.66 g/mol. Its IUPAC name is (3S)-3-[4-[[4-[(1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[4-[(1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 51357276 |
| Molecular Formula | C33H36N2O3 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (3S)-3-[4-[[4-[(1-methylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc(CN3CCC4(CC3)CN(C)c3ccccc34)cc2)cc1 |
| InChI | InChI=1S/C33H36N2O3/c1-3-6-28(21-32(36)37)27-13-15-29(16-14-27)38-23-26-11-9-25(10-12-26)22-35-19-17-33(18-20-35)24-34(2)31-8-5-4-7-30(31)33/h4-5,7-16,28H,17-24H2,1-2H3,(H,36,37)/t28-/m0/s1 |
| InChIKey | QRCCYPSGLCYDNW-NDEPHWFRSA-N |
| XLogP | 5.83 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|