C28H33FN2O4 — CID 162667431
2-[[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl (E)-4-(4-methylphenyl)-4-oxobut-2-enoate (PubChem CID 162667431) has the molecular formula C28H33FN2O4 and a molecular weight of 480.58 g/mol. Its IUPAC name is 2-[[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl (E)-4-(4-methylphenyl)-4-oxobut-2-enoate.
| Compound Name | 2-[[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl (E)-4-(4-methylphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 162667431 |
| Molecular Formula | C28H33FN2O4 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 2-[[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl (E)-4-(4-methylphenyl)-4-oxobut-2-enoate |
| SMILES | Cc1ccc(C(=O)/C=C/C(=O)OCCN(C)C(C(=O)NC2CCCCC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H33FN2O4/c1-20-8-10-21(11-9-20)25(32)16-17-26(33)35-19-18-31(2)27(22-12-14-23(29)15-13-22)28(34)30-24-6-4-3-5-7-24/h8-17,24,27H,3-7,18-19H2,1-2H3,(H,30,34)/b17-16+ |
| InChIKey | KLJFMKGGTCMJKN-WUKNDPDISA-N |
| XLogP | 4.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|