C37H16F10N4O — CID 162668394
4-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenol (PubChem CID 162668394) has the molecular formula C37H16F10N4O and a molecular weight of 722.54 g/mol. Its IUPAC name is 4-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenol.
| Compound Name | 4-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenol |
|---|---|
| PubChem CID | 162668394 |
| Molecular Formula | C37H16F10N4O |
| Molecular Weight | 722.54 g/mol |
| Exact Mass | 722.12 |
| IUPAC Name | 4-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenol |
| SMILES | Oc1ccc(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C37H16F10N4O/c38-28-26(29(39)33(43)36(46)32(28)42)24-19-7-5-15(48-19)16-6-8-20(49-16)25(27-30(40)34(44)37(47)35(45)31(27)41)22-12-10-18(51-22)23(17-9-11-21(24)50-17)13-1-3-14(52)4-2-13/h1-12,48-50,52H/b16-15-,23-17-,23-18-,24-19+,24-21+,25-20+,25-22+ |
| InChIKey | MHOAIVUYWCHQTE-SZJGTTMVSA-N |
| XLogP | 10.79 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.54 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|