C26H29N3O4 — CID 162669983
[1-(propan-2-ylcarbamoyloxymethyl)pyrrolo[1,2-f]phenanthridin-2-yl]methyl N-propan-2-ylcarbamate (PubChem CID 162669983) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is [1-(propan-2-ylcarbamoyloxymethyl)pyrrolo[1,2-f]phenanthridin-2-yl]methyl N-propan-2-ylcarbamate.
| Compound Name | [1-(propan-2-ylcarbamoyloxymethyl)pyrrolo[1,2-f]phenanthridin-2-yl]methyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 162669983 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | [1-(propan-2-ylcarbamoyloxymethyl)pyrrolo[1,2-f]phenanthridin-2-yl]methyl N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OCc1cn2c3ccccc3c3ccccc3c2c1COC(=O)NC(C)C |
| InChI | InChI=1S/C26H29N3O4/c1-16(2)27-25(30)32-14-18-13-29-23-12-8-7-10-20(23)19-9-5-6-11-21(19)24(29)22(18)15-33-26(31)28-17(3)4/h5-13,16-17H,14-15H2,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | AGAKUIVZEKUIKG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|