C29H47N3O3 — CID 162671292
N-[3-(diethylamino)propyl]-1-ethyl-4-[3-[4-(2-hydroxypropoxy)-3-methylphenyl]pentan-3-yl]pyrrole-2-carboxamide (PubChem CID 162671292) has the molecular formula C29H47N3O3 and a molecular weight of 485.71 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-ethyl-4-[3-[4-(2-hydroxypropoxy)-3-methylphenyl]pentan-3-yl]pyrrole-2-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-ethyl-4-[3-[4-(2-hydroxypropoxy)-3-methylphenyl]pentan-3-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162671292 |
| Molecular Formula | C29H47N3O3 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.36 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-ethyl-4-[3-[4-(2-hydroxypropoxy)-3-methylphenyl]pentan-3-yl]pyrrole-2-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1cc(C(CC)(CC)c2ccc(OCC(C)O)c(C)c2)cn1CC |
| InChI | InChI=1S/C29H47N3O3/c1-8-29(9-2,24-14-15-27(22(6)18-24)35-21-23(7)33)25-19-26(32(12-5)20-25)28(34)30-16-13-17-31(10-3)11-4/h14-15,18-20,23,33H,8-13,16-17,21H2,1-7H3,(H,30,34) |
| InChIKey | LIXGFJPNLVCRNX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|