About 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile
1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile (PubChem CID 162671818) has the molecular formula C14H8N4O
and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile |
| PubChem CID | 162671818 |
| Molecular Formula | C14H8N4O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1nn(C(=O)c2ccccc2)c2ncccc12 |
| InChI | InChI=1S/C14H8N4O/c15-9-12-11-7-4-8-16-13(11)18(17-12)14(19)10-5-2-1-3-6-10/h1-8H |
| InChIKey | PYOQKWGRBUQSNT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile?
The IUPAC name of 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile (CID 162671818) is 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile.
What is the SMILES notation for 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile?
The canonical SMILES for 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile is N#Cc1nn(C(=O)c2ccccc2)c2ncccc12.
What is the InChIKey of 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile?
The InChIKey is PYOQKWGRBUQSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4O/c15-9-12-11-7-4-8-16-13(11)18(17-12)14(19)10-5-2-1-3-6-10/h1-8H.
What are the key properties of 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile?
1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile has a molecular weight of 248.25 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzoylpyrazolo[3,4-b]pyridine-3-carbonitrile is sourced from PubChem (CID 162671818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).