About 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide
3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide (PubChem CID 91369447) has the molecular formula C13H10N4O3S
and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide |
| PubChem CID | 91369447 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide |
| SMILES | NS(=O)(=O)n1nc(C(=O)c2ccccc2)c2cccnc21 |
| InChI | InChI=1S/C13H10N4O3S/c14-21(19,20)17-13-10(7-4-8-15-13)11(16-17)12(18)9-5-2-1-3-6-9/h1-8H,(H2,14,19,20) |
| InChIKey | QPWNPMDNMAKUKC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide?
The IUPAC name of 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide (CID 91369447) is 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide.
What is the SMILES notation for 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide?
The canonical SMILES for 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide is NS(=O)(=O)n1nc(C(=O)c2ccccc2)c2cccnc21.
What is the InChIKey of 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide?
The InChIKey is QPWNPMDNMAKUKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O3S/c14-21(19,20)17-13-10(7-4-8-15-13)11(16-17)12(18)9-5-2-1-3-6-9/h1-8H,(H2,14,19,20).
What are the key properties of 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide?
3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide has a molecular weight of 302.31 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoylpyrazolo[5,4-b]pyridine-1-sulfonamide is sourced from PubChem (CID 91369447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).