C18H9F3N4O5S2 — CID 58266643
[8-(benzenesulfonyl)-4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl] trifluoromethanesulfonate (PubChem CID 58266643) has the molecular formula C18H9F3N4O5S2 and a molecular weight of 482.42 g/mol. Its IUPAC name is [8-(benzenesulfonyl)-4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl] trifluoromethanesulfonate.
| Compound Name | [8-(benzenesulfonyl)-4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58266643 |
| Molecular Formula | C18H9F3N4O5S2 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | [8-(benzenesulfonyl)-4-cyano-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl] trifluoromethanesulfonate |
| SMILES | N#Cc1ncc2c(c1OS(=O)(=O)C(F)(F)F)c1cccnc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H9F3N4O5S2/c19-18(20,21)32(28,29)30-16-13(9-22)24-10-14-15(16)12-7-4-8-23-17(12)25(14)31(26,27)11-5-2-1-3-6-11/h1-8,10H |
| InChIKey | FEBLRVOHKYKNQH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 132.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|