C19H17N3O2S — CID 58514526
2-[9-(benzenesulfonyl)pyrido[2,3-b]indol-6-yl]ethanamine (PubChem CID 58514526) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[9-(benzenesulfonyl)pyrido[2,3-b]indol-6-yl]ethanamine.
| Compound Name | 2-[9-(benzenesulfonyl)pyrido[2,3-b]indol-6-yl]ethanamine |
|---|---|
| PubChem CID | 58514526 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-[9-(benzenesulfonyl)pyrido[2,3-b]indol-6-yl]ethanamine |
| SMILES | NCCc1ccc2c(c1)c1cccnc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S/c20-11-10-14-8-9-18-17(13-14)16-7-4-12-21-19(16)22(18)25(23,24)15-5-2-1-3-6-15/h1-9,12-13H,10-11,20H2 |
| InChIKey | JYGKGIQUKBQXDZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |