C13H13N3 — CID 91225284
6-ethylpyrido[2,3-b]indol-9-amine (PubChem CID 91225284) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 6-ethylpyrido[2,3-b]indol-9-amine.
| Compound Name | 6-ethylpyrido[2,3-b]indol-9-amine |
|---|---|
| PubChem CID | 91225284 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 6-ethylpyrido[2,3-b]indol-9-amine |
| SMILES | CCc1ccc2c(c1)c1cccnc1n2N |
| InChI | InChI=1S/C13H13N3/c1-2-9-5-6-12-11(8-9)10-4-3-7-15-13(10)16(12)14/h3-8H,2,14H2,1H3 |
| InChIKey | ZPLWCZWVBPDCNA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |