C17H11F3N4O5S2 — CID 89120761
[4-amino-8-(benzenesulfonyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl] trifluoromethanesulfonate (PubChem CID 89120761) has the molecular formula C17H11F3N4O5S2 and a molecular weight of 472.43 g/mol. Its IUPAC name is [4-amino-8-(benzenesulfonyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl] trifluoromethanesulfonate.
| Compound Name | [4-amino-8-(benzenesulfonyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89120761 |
| Molecular Formula | C17H11F3N4O5S2 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | [4-amino-8-(benzenesulfonyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-3-yl] trifluoromethanesulfonate |
| SMILES | Nc1ncc2c(c1OS(=O)(=O)C(F)(F)F)c1cccnc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H11F3N4O5S2/c18-17(19,20)31(27,28)29-14-13-11-7-4-8-22-16(11)24(12(13)9-23-15(14)21)30(25,26)10-5-2-1-3-6-10/h1-9H,(H2,21,23) |
| InChIKey | LCVXGZHCNNNCPM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|