C12H5F6N3O5S2 — CID 86655587
[8-(trifluoromethylsulfonyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl] trifluoromethanesulfonate (PubChem CID 86655587) has the molecular formula C12H5F6N3O5S2 and a molecular weight of 449.31 g/mol. Its IUPAC name is [8-(trifluoromethylsulfonyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl] trifluoromethanesulfonate.
| Compound Name | [8-(trifluoromethylsulfonyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86655587 |
| Molecular Formula | C12H5F6N3O5S2 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.96 |
| IUPAC Name | [8-(trifluoromethylsulfonyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c3cccnc3n(S(=O)(=O)C(F)(F)F)c2cn1)C(F)(F)F |
| InChI | InChI=1S/C12H5F6N3O5S2/c13-11(14,15)27(22,23)21-8-5-20-9(26-28(24,25)12(16,17)18)4-7(8)6-2-1-3-19-10(6)21/h1-5H |
| InChIKey | SGPKEWRFJGAJKR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 108.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|