C27H26N8O2 — CID 162673748
3-[[6-[2-[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]pyrimidin-5-yl]-2,2-dimethyl-3-oxoindol-1-yl]methyl]pyridine-2-carbonitrile (PubChem CID 162673748) has the molecular formula C27H26N8O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is 3-[[6-[2-[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]pyrimidin-5-yl]-2,2-dimethyl-3-oxoindol-1-yl]methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[[6-[2-[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]pyrimidin-5-yl]-2,2-dimethyl-3-oxoindol-1-yl]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 162673748 |
| Molecular Formula | C27H26N8O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 3-[[6-[2-[(8aR)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]pyrimidin-5-yl]-2,2-dimethyl-3-oxoindol-1-yl]methyl]pyridine-2-carbonitrile |
| SMILES | CC1(C)C(=O)c2ccc(-c3cnc(N4CCN5C(=O)NC[C@@H]5C4)nc3)cc2N1Cc1cccnc1C#N |
| InChI | InChI=1S/C27H26N8O2/c1-27(2)24(36)21-6-5-17(10-23(21)35(27)15-18-4-3-7-29-22(18)11-28)19-12-30-25(31-13-19)33-8-9-34-20(16-33)14-32-26(34)37/h3-7,10,12-13,20H,8-9,14-16H2,1-2H3,(H,32,37)/t20-/m1/s1 |
| InChIKey | GWNZYBKAOUOJHU-HXUWFJFHSA-N |
| XLogP | 2.61 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |