C21H19F3N2O2S — CID 162675931
(5Z)-5-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-3-(2-methylphenyl)-2-propylimino-1,3-thiazolidin-4-one (PubChem CID 162675931) has the molecular formula C21H19F3N2O2S and a molecular weight of 420.46 g/mol. Its IUPAC name is (5Z)-5-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-3-(2-methylphenyl)-2-propylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-3-(2-methylphenyl)-2-propylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162675931 |
| Molecular Formula | C21H19F3N2O2S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (5Z)-5-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-3-(2-methylphenyl)-2-propylimino-1,3-thiazolidin-4-one |
| SMILES | CCC/N=C1\S/C(=C\c2ccc(O)c(C(F)(F)F)c2)C(=O)N1c1ccccc1C |
| InChI | InChI=1S/C21H19F3N2O2S/c1-3-10-25-20-26(16-7-5-4-6-13(16)2)19(28)18(29-20)12-14-8-9-17(27)15(11-14)21(22,23)24/h4-9,11-12,27H,3,10H2,1-2H3/b18-12-,25-20- |
| InChIKey | PEGPVTBAMDVJHL-NQMSZFHHSA-N |
| XLogP | 5.61 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|