C17H12F9NO3S — CID 76527597
5-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-3-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butyl]-1,3-thiazolidine-2,4-dione (PubChem CID 76527597) has the molecular formula C17H12F9NO3S and a molecular weight of 481.34 g/mol. Its IUPAC name is 5-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-3-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-3-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76527597 |
| Molecular Formula | C17H12F9NO3S |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 5-[[4-hydroxy-3-(trifluoromethyl)phenyl]methylidene]-3-[4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(O)c(C(F)(F)F)c2)C(=O)N1CC(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C17H12F9NO3S/c18-15(19,20)5-9(6-16(21,22)23)7-27-13(29)12(31-14(27)30)4-8-1-2-11(28)10(3-8)17(24,25)26/h1-4,9,28H,5-7H2 |
| InChIKey | PGNASGVBCNLHMR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|