C21H18F3NO4S — CID 75628131
5-[[3,4-dihydroxy-5-(trifluoromethyl)phenyl]methylidene]-3-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 75628131) has the molecular formula C21H18F3NO4S and a molecular weight of 437.44 g/mol. Its IUPAC name is 5-[[3,4-dihydroxy-5-(trifluoromethyl)phenyl]methylidene]-3-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3,4-dihydroxy-5-(trifluoromethyl)phenyl]methylidene]-3-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75628131 |
| Molecular Formula | C21H18F3NO4S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 5-[[3,4-dihydroxy-5-(trifluoromethyl)phenyl]methylidene]-3-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(CN2C(=O)SC(=Cc3cc(O)c(O)c(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H18F3NO4S/c1-11(2)14-5-3-12(4-6-14)10-25-19(28)17(30-20(25)29)9-13-7-15(21(22,23)24)18(27)16(26)8-13/h3-9,11,26-27H,10H2,1-2H3 |
| InChIKey | PSCQHOABYUCDLG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|