C26H32N4O3 — CID 162676478
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2S)-1-(N-methylanilino)-3-phenylpropan-2-yl]acetamide (PubChem CID 162676478) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2S)-1-(N-methylanilino)-3-phenylpropan-2-yl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2S)-1-(N-methylanilino)-3-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 162676478 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2S)-1-(N-methylanilino)-3-phenylpropan-2-yl]acetamide |
| SMILES | CN(C[C@H](Cc1ccccc1)NC(=O)CN1C(=O)NC2(CCCCC2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H32N4O3/c1-29(22-13-7-3-8-14-22)18-21(17-20-11-5-2-6-12-20)27-23(31)19-30-24(32)26(28-25(30)33)15-9-4-10-16-26/h2-3,5-8,11-14,21H,4,9-10,15-19H2,1H3,(H,27,31)(H,28,33)/t21-/m0/s1 |
| InChIKey | LHZRRJIXNXPHNI-NRFANRHFSA-N |
| XLogP | 3.11 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|