C16H15BrF3N3O — CID 162677030
7-bromo-3,6,6-trimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]-5,7-dihydroindazol-4-one (PubChem CID 162677030) has the molecular formula C16H15BrF3N3O and a molecular weight of 402.21 g/mol. Its IUPAC name is 7-bromo-3,6,6-trimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]-5,7-dihydroindazol-4-one.
| Compound Name | 7-bromo-3,6,6-trimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 162677030 |
| Molecular Formula | C16H15BrF3N3O |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 7-bromo-3,6,6-trimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]-5,7-dihydroindazol-4-one |
| SMILES | Cc1nn(-c2ccc(C(F)(F)F)cn2)c2c1C(=O)CC(C)(C)C2Br |
| InChI | InChI=1S/C16H15BrF3N3O/c1-8-12-10(24)6-15(2,3)14(17)13(12)23(22-8)11-5-4-9(7-21-11)16(18,19)20/h4-5,7,14H,6H2,1-3H3 |
| InChIKey | MBHGHBLPUNDZRO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|