C15H15BrN4O3 — CID 162652072
7-bromo-3,6,6-trimethyl-1-(5-nitro-2-pyridinyl)-5,7-dihydroindazol-4-one (PubChem CID 162652072) has the molecular formula C15H15BrN4O3 and a molecular weight of 379.21 g/mol. Its IUPAC name is 7-bromo-3,6,6-trimethyl-1-(5-nitro-2-pyridinyl)-5,7-dihydroindazol-4-one.
| Compound Name | 7-bromo-3,6,6-trimethyl-1-(5-nitro-2-pyridinyl)-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 162652072 |
| Molecular Formula | C15H15BrN4O3 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 7-bromo-3,6,6-trimethyl-1-(5-nitro-2-pyridinyl)-5,7-dihydroindazol-4-one |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cn2)c2c1C(=O)CC(C)(C)C2Br |
| InChI | InChI=1S/C15H15BrN4O3/c1-8-12-10(21)6-15(2,3)14(16)13(12)19(18-8)11-5-4-9(7-17-11)20(22)23/h4-5,7,14H,6H2,1-3H3 |
| InChIKey | SACWVZGRVDPMSQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|