C9H8N4O4 — CID 166553476
1-(5-nitro-2-pyridinyl)-1,3-diazinane-2,4-dione (PubChem CID 166553476) has the molecular formula C9H8N4O4 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-(5-nitro-2-pyridinyl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(5-nitro-2-pyridinyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 166553476 |
| Molecular Formula | C9H8N4O4 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1-(5-nitro-2-pyridinyl)-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccc([N+](=O)[O-])cn2)C(=O)N1 |
| InChI | InChI=1S/C9H8N4O4/c14-8-3-4-12(9(15)11-8)7-2-1-6(5-10-7)13(16)17/h1-2,5H,3-4H2,(H,11,14,15) |
| InChIKey | KEQSFNKETGKNCE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|