C8H7N3O3S — CID 53396679
3-(5-nitro-2-pyridinyl)-1,3-thiazolidin-2-one (PubChem CID 53396679) has the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. Its IUPAC name is 3-(5-nitro-2-pyridinyl)-1,3-thiazolidin-2-one.
| Compound Name | 3-(5-nitro-2-pyridinyl)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 53396679 |
| Molecular Formula | C8H7N3O3S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 3-(5-nitro-2-pyridinyl)-1,3-thiazolidin-2-one |
| SMILES | O=C1SCCN1c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C8H7N3O3S/c12-8-10(3-4-15-8)7-2-1-6(5-9-7)11(13)14/h1-2,5H,3-4H2 |
| InChIKey | OOOLRBMERVKWRU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|