C15H12N4O3S — CID 162677336
4-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-hydroxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 162677336) has the molecular formula C15H12N4O3S and a molecular weight of 328.35 g/mol. Its IUPAC name is 4-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-hydroxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-hydroxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 162677336 |
| Molecular Formula | C15H12N4O3S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-hydroxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Oc1ccc(/C=N/n2c(-c3ccccc3O)n[nH]c2=S)c(O)c1 |
| InChI | InChI=1S/C15H12N4O3S/c20-10-6-5-9(13(22)7-10)8-16-19-14(17-18-15(19)23)11-3-1-2-4-12(11)21/h1-8,20-22H,(H,18,23)/b16-8+ |
| InChIKey | BXCFEOGOTUYPHE-LZYBPNLTSA-N |
| XLogP | 2.61 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|