C28H27F3N6S2 — CID 162677458
N-[(Z)-[1-[1-ethyl-5-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine (PubChem CID 162677458) has the molecular formula C28H27F3N6S2 and a molecular weight of 568.69 g/mol. Its IUPAC name is N-[(Z)-[1-[1-ethyl-5-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-[1-[1-ethyl-5-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 162677458 |
| Molecular Formula | C28H27F3N6S2 |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | N-[(Z)-[1-[1-ethyl-5-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]indol-3-yl]-2,2,2-trifluoroethylidene]amino]-1,3-benzothiazol-2-amine |
| SMILES | CCn1cc(/C(=N/Nc2nc3ccccc3s2)C(F)(F)F)c2cc(-c3nc(CN4CCCCC4)cs3)ccc21 |
| InChI | InChI=1S/C28H27F3N6S2/c1-2-37-16-21(25(28(29,30)31)34-35-27-33-22-8-4-5-9-24(22)39-27)20-14-18(10-11-23(20)37)26-32-19(17-38-26)15-36-12-6-3-7-13-36/h4-5,8-11,14,16-17H,2-3,6-7,12-13,15H2,1H3,(H,33,35)/b34-25- |
| InChIKey | LKCCSINORLEOQN-NQUVTRGKSA-N |
| XLogP | 7.76 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|