C6H3F6O3- — CID 162679438
2-(1,1,2,4,4,4-hexafluorobut-2-enoxy)acetate (PubChem CID 162679438) has the molecular formula C6H3F6O3- and a molecular weight of 237.07 g/mol. Its IUPAC name is 2-(1,1,2,4,4,4-hexafluorobut-2-enoxy)acetate.
| Compound Name | 2-(1,1,2,4,4,4-hexafluorobut-2-enoxy)acetate |
|---|---|
| PubChem CID | 162679438 |
| Molecular Formula | C6H3F6O3- |
| Molecular Weight | 237.07 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 2-(1,1,2,4,4,4-hexafluorobut-2-enoxy)acetate |
| SMILES | O=C([O-])COC(F)(F)C(F)=CC(F)(F)F |
| InChI | InChI=1S/C6H4F6O3/c7-3(1-5(8,9)10)6(11,12)15-2-4(13)14/h1H,2H2,(H,13,14)/p-1 |
| InChIKey | ZFZXIMMYKHEGKN-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.07 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |