C20H22ClFN2O4 — CID 162684258
tert-butyl N-[4-chloro-3-fluoro-2-[(3S)-3-formyl-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-7-yl]phenyl]carbamate (PubChem CID 162684258) has the molecular formula C20H22ClFN2O4 and a molecular weight of 408.86 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-3-fluoro-2-[(3S)-3-formyl-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-7-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-chloro-3-fluoro-2-[(3S)-3-formyl-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-7-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 162684258 |
| Molecular Formula | C20H22ClFN2O4 |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | tert-butyl N-[4-chloro-3-fluoro-2-[(3S)-3-formyl-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-7-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)c(F)c1C1=CC(=O)N2C(CC[C@H]2C=O)C1 |
| InChI | InChI=1S/C20H22ClFN2O4/c1-20(2,3)28-19(27)23-15-7-6-14(21)18(22)17(15)11-8-12-4-5-13(10-25)24(12)16(26)9-11/h6-7,9-10,12-13H,4-5,8H2,1-3H3,(H,23,27)/t12?,13-/m0/s1 |
| InChIKey | AOCIVDJKFYDQSI-ABLWVSNPSA-N |
| XLogP | 4.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|