C19H15ClN6OS — CID 162686448
(4-chlorophenyl)-[(8R)-8-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 162686448) has the molecular formula C19H15ClN6OS and a molecular weight of 410.89 g/mol. Its IUPAC name is (4-chlorophenyl)-[(8R)-8-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(8R)-8-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 162686448 |
| Molecular Formula | C19H15ClN6OS |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | (4-chlorophenyl)-[(8R)-8-methyl-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | C[C@@H]1c2nnc(-c3nc4cccnc4s3)n2CCN1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN6OS/c1-11-15-23-24-16(18-22-14-3-2-8-21-17(14)28-18)26(15)10-9-25(11)19(27)12-4-6-13(20)7-5-12/h2-8,11H,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | IZBCZVXXNARYCK-LLVKDONJSA-N |
| XLogP | 3.82 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |