C20H19F3N2O — CID 162687972
N-methyl-N-[1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 162687972) has the molecular formula C20H19F3N2O and a molecular weight of 360.38 g/mol. Its IUPAC name is N-methyl-N-[1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | N-methyl-N-[1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 162687972 |
| Molecular Formula | C20H19F3N2O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-methyl-N-[1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccc2c(c1)CCC2Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N2O/c1-3-19(26)25(2)16-8-9-17-13(11-16)7-10-18(17)24-15-6-4-5-14(12-15)20(21,22)23/h3-6,8-9,11-12,18,24H,1,7,10H2,2H3 |
| InChIKey | WKYDZNOBEAUFBJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|