C21H20F3N3O3 — CID 162688586
6-cyclopropyl-3-[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino]pyrazine-2-carbaldehyde (PubChem CID 162688586) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 6-cyclopropyl-3-[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino]pyrazine-2-carbaldehyde.
| Compound Name | 6-cyclopropyl-3-[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino]pyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 162688586 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 6-cyclopropyl-3-[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino]pyrazine-2-carbaldehyde |
| SMILES | O=Cc1nc(C2CC2)cnc1Nc1cccc(C2=CCOCC2)c1OCC(F)(F)F |
| InChI | InChI=1S/C21H20F3N3O3/c22-21(23,24)12-30-19-15(13-6-8-29-9-7-13)2-1-3-16(19)27-20-18(11-28)26-17(10-25-20)14-4-5-14/h1-3,6,10-11,14H,4-5,7-9,12H2,(H,25,27) |
| InChIKey | PJGURUDDKCPAMV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|