C18H16F3N3O4 — CID 175714663
[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino] pyrazine-2-carboxylate (PubChem CID 175714663) has the molecular formula C18H16F3N3O4 and a molecular weight of 395.34 g/mol. Its IUPAC name is [3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino] pyrazine-2-carboxylate.
| Compound Name | [3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 175714663 |
| Molecular Formula | C18H16F3N3O4 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino] pyrazine-2-carboxylate |
| SMILES | O=C(ONc1cccc(C2=CCOCC2)c1OCC(F)(F)F)c1cnccn1 |
| InChI | InChI=1S/C18H16F3N3O4/c19-18(20,21)11-27-16-13(12-4-8-26-9-5-12)2-1-3-14(16)24-28-17(25)15-10-22-6-7-23-15/h1-4,6-7,10,24H,5,8-9,11H2 |
| InChIKey | AHKHQYKZIKPAED-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|