C18H16F3N3O3 — CID 175714595
3-[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino]pyrazine-2-carbaldehyde (PubChem CID 175714595) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is 3-[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino]pyrazine-2-carbaldehyde.
| Compound Name | 3-[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino]pyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 175714595 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-[3-(3,6-dihydro-2H-pyran-4-yl)-2-(2,2,2-trifluoroethoxy)anilino]pyrazine-2-carbaldehyde |
| SMILES | O=Cc1nccnc1Nc1cccc(C2=CCOCC2)c1OCC(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O3/c19-18(20,21)11-27-16-13(12-4-8-26-9-5-12)2-1-3-14(16)24-17-15(10-25)22-6-7-23-17/h1-4,6-7,10H,5,8-9,11H2,(H,23,24) |
| InChIKey | MBKUUYMABULWKL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|