C19H21N3O4 — CID 162688946
4,11-dihydroxy-3,8-dimethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione (PubChem CID 162688946) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 4,11-dihydroxy-3,8-dimethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione.
| Compound Name | 4,11-dihydroxy-3,8-dimethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 162688946 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4,11-dihydroxy-3,8-dimethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
| SMILES | CN1C(=O)c2c(O)c(=O)ccn2N2C1CCC(O)C2(C)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O4/c1-19(12-6-4-3-5-7-12)14(24)8-9-15-20(2)18(26)16-17(25)13(23)10-11-21(16)22(15)19/h3-7,10-11,14-15,24-25H,8-9H2,1-2H3 |
| InChIKey | JABYDONKVNHPHX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |