C27H26F3N3O4 — CID 162688988
3-[2-(difluoromethoxy)-5-fluorophenyl]-5,8-dimethyl-11-phenylmethoxy-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione (PubChem CID 162688988) has the molecular formula C27H26F3N3O4 and a molecular weight of 513.52 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)-5-fluorophenyl]-5,8-dimethyl-11-phenylmethoxy-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione.
| Compound Name | 3-[2-(difluoromethoxy)-5-fluorophenyl]-5,8-dimethyl-11-phenylmethoxy-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 162688988 |
| Molecular Formula | C27H26F3N3O4 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 3-[2-(difluoromethoxy)-5-fluorophenyl]-5,8-dimethyl-11-phenylmethoxy-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
| SMILES | CC1CC(c2cc(F)ccc2OC(F)F)N2C(C1)N(C)C(=O)c1c(OCc3ccccc3)c(=O)ccn12 |
| InChI | InChI=1S/C27H26F3N3O4/c1-16-12-20(19-14-18(28)8-9-22(19)37-27(29)30)33-23(13-16)31(2)26(35)24-25(21(34)10-11-32(24)33)36-15-17-6-4-3-5-7-17/h3-11,14,16,20,23,27H,12-13,15H2,1-2H3 |
| InChIKey | ICGMIIPOIMYTFZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |