C30H37IN2O3Si — CID 162691503
tert-butyl-[3-[(4-iodo-6-morpholin-4-yl-2-pyridinyl)oxy]-1-methylcyclobutyl]oxy-diphenylsilane (PubChem CID 162691503) has the molecular formula C30H37IN2O3Si and a molecular weight of 628.63 g/mol. Its IUPAC name is tert-butyl-[3-[(4-iodo-6-morpholin-4-yl-2-pyridinyl)oxy]-1-methylcyclobutyl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[3-[(4-iodo-6-morpholin-4-yl-2-pyridinyl)oxy]-1-methylcyclobutyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 162691503 |
| Molecular Formula | C30H37IN2O3Si |
| Molecular Weight | 628.63 g/mol |
| Exact Mass | 628.16 |
| IUPAC Name | tert-butyl-[3-[(4-iodo-6-morpholin-4-yl-2-pyridinyl)oxy]-1-methylcyclobutyl]oxy-diphenylsilane |
| SMILES | CC1(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(Oc2cc(I)cc(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C30H37IN2O3Si/c1-29(2,3)37(25-11-7-5-8-12-25,26-13-9-6-10-14-26)36-30(4)21-24(22-30)35-28-20-23(31)19-27(32-28)33-15-17-34-18-16-33/h5-14,19-20,24H,15-18,21-22H2,1-4H3 |
| InChIKey | HWKJPQJZALGJCA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|