C27H33N3O4Si — CID 22242819
[2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-oxazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 22242819) has the molecular formula C27H33N3O4Si and a molecular weight of 491.66 g/mol. Its IUPAC name is [2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-oxazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 22242819 |
| Molecular Formula | C27H33N3O4Si |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-oxazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)(C)[Si](OC1CN(c2nc(C(=O)N3CCOCC3)co2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33N3O4Si/c1-27(2,3)35(22-10-6-4-7-11-22,23-12-8-5-9-13-23)34-21-18-30(19-21)26-28-24(20-33-26)25(31)29-14-16-32-17-15-29/h4-13,20-21H,14-19H2,1-3H3 |
| InChIKey | LYBSVMKDGMCALA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|