C14H22N2O4 — CID 162695424
tert-butyl N-[(2S)-1-hydroxy-3-(5-oxo-4-azaspiro[2.4]heptan-6-ylidene)propan-2-yl]carbamate (PubChem CID 162695424) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-hydroxy-3-(5-oxo-4-azaspiro[2.4]heptan-6-ylidene)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-hydroxy-3-(5-oxo-4-azaspiro[2.4]heptan-6-ylidene)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 162695424 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl N-[(2S)-1-hydroxy-3-(5-oxo-4-azaspiro[2.4]heptan-6-ylidene)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C=C1CC2(CC2)NC1=O)CO |
| InChI | InChI=1S/C14H22N2O4/c1-13(2,3)20-12(19)15-10(8-17)6-9-7-14(4-5-14)16-11(9)18/h6,10,17H,4-5,7-8H2,1-3H3,(H,15,19)(H,16,18)/t10-/m0/s1 |
| InChIKey | ICTLTLIZKLSOQI-JTQLQIEISA-N |
| XLogP | 0.85 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|