C26H26N2O6 — CID 162695742
(3S,3aS,6aR)-2-(4-methoxy-1-phenylmethoxycarbonylindole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 162695742) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-(4-methoxy-1-phenylmethoxycarbonylindole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | (3S,3aS,6aR)-2-(4-methoxy-1-phenylmethoxycarbonylindole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 162695742 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (3S,3aS,6aR)-2-(4-methoxy-1-phenylmethoxycarbonylindole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | COc1cccc2c1cc(C(=O)N1C[C@@H]3CCC[C@@H]3[C@H]1C(=O)O)n2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H26N2O6/c1-33-22-12-6-11-20-19(22)13-21(28(20)26(32)34-15-16-7-3-2-4-8-16)24(29)27-14-17-9-5-10-18(17)23(27)25(30)31/h2-4,6-8,11-13,17-18,23H,5,9-10,14-15H2,1H3,(H,30,31)/t17-,18-,23-/m0/s1 |
| InChIKey | FQXLYZMVOBORMI-BSRJHKFKSA-N |
| XLogP | 4.16 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |