C58H46N5Pt-3 — CID 162696234
N-phenyl-9-[4-(2-phenyl-2-adamantyl)-2-pyridinyl]-N-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]-1H-carbazol-1-id-2-amine;platinum (PubChem CID 162696234) has the molecular formula C58H46N5Pt-3 and a molecular weight of 1008.12 g/mol. Its IUPAC name is N-phenyl-9-[4-(2-phenyl-2-adamantyl)-2-pyridinyl]-N-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]-1H-carbazol-1-id-2-amine;platinum.
| Compound Name | N-phenyl-9-[4-(2-phenyl-2-adamantyl)-2-pyridinyl]-N-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]-1H-carbazol-1-id-2-amine;platinum |
|---|---|
| PubChem CID | 162696234 |
| Molecular Formula | C58H46N5Pt-3 |
| Molecular Weight | 1008.12 g/mol |
| Exact Mass | 1007.34 |
| IUPAC Name | N-phenyl-9-[4-(2-phenyl-2-adamantyl)-2-pyridinyl]-N-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]-1H-carbazol-1-id-2-amine;platinum |
| SMILES | [Pt].[c-]1c(N2[CH-]N(c3ccccc3)c3ccccc32)cccc1N(c1[c-]c2c(cc1)c1ccccc1n2-c1cc(C2(c3ccccc3)C3CC4CC(C3)CC2C4)ccn1)c1ccccc1 |
| InChI | InChI=1S/C58H46N5.Pt/c1-4-15-42(16-5-1)58(44-32-40-31-41(34-44)35-45(58)33-40)43-29-30-59-57(36-43)63-53-24-11-10-23-51(53)52-28-27-50(38-56(52)63)62(47-19-8-3-9-20-47)49-22-14-21-48(37-49)61-39-60(46-17-6-2-7-18-46)54-25-12-13-26-55(54)61;/h1-30,36,39-41,44-45H,31-35H2;/q-3; |
| InChIKey | CTFLPJLNKWVCLW-UHFFFAOYSA-N |
| XLogP | 14.40 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.12 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|