C28H37NO7 — CID 162697125
[(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (E,2S)-2-ethyl-2,6-dihydroxy-6-methylhept-4-enoate (PubChem CID 162697125) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is [(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (E,2S)-2-ethyl-2,6-dihydroxy-6-methylhept-4-enoate.
| Compound Name | [(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (E,2S)-2-ethyl-2,6-dihydroxy-6-methylhept-4-enoate |
|---|---|
| PubChem CID | 162697125 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | [(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (E,2S)-2-ethyl-2,6-dihydroxy-6-methylhept-4-enoate |
| SMILES | CC[C@](O)(C/C=C/C(C)(C)O)C(=O)O[C@@H]1C(OC)=C[C@]23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| InChI | InChI=1S/C28H37NO7/c1-5-28(32,11-6-9-26(2,3)31)25(30)36-24-22(33-4)16-27-10-7-12-29(27)13-8-18-14-20-21(35-17-34-20)15-19(18)23(24)27/h6,9,14-16,23-24,31-32H,5,7-8,10-13,17H2,1-4H3/b9-6+/t23-,24-,27+,28+/m1/s1 |
| InChIKey | AQGTVQMXIYLAHH-DHKOARCJSA-N |
| XLogP | 3.20 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|