C34H46F6O9 — CID 162701210
3-O-(2-oxooxolan-3-yl) 5-O-(2-phenylpropan-2-yl) 1-O-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexan-3-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 162701210) has the molecular formula C34H46F6O9 and a molecular weight of 712.72 g/mol. Its IUPAC name is 3-O-(2-oxooxolan-3-yl) 5-O-(2-phenylpropan-2-yl) 1-O-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexan-3-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(2-oxooxolan-3-yl) 5-O-(2-phenylpropan-2-yl) 1-O-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexan-3-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 162701210 |
| Molecular Formula | C34H46F6O9 |
| Molecular Weight | 712.72 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | 3-O-(2-oxooxolan-3-yl) 5-O-(2-phenylpropan-2-yl) 1-O-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexan-3-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(CC(O)(C(F)(F)F)C(F)(F)F)OC(=O)C(C)(C)CC(C)(CC(C)(CC)C(=O)OC(C)(C)c1ccccc1)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C34H46F6O9/c1-9-22(18-32(45,33(35,36)37)34(38,39)40)47-25(42)28(3,4)19-31(8,26(43)48-23-16-17-46-24(23)41)20-30(7,10-2)27(44)49-29(5,6)21-14-12-11-13-15-21/h11-15,22-23,45H,9-10,16-20H2,1-8H3 |
| InChIKey | UFRRKKADARDGKS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.72 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|