C36H50F6O9 — CID 162701228
3-O-(2-oxooxolan-3-yl) 5-O-(2-phenylpropan-2-yl) 1-O-[1,1,1-trifluoro-2-hydroxy-6-methyl-2-(trifluoromethyl)heptan-4-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 162701228) has the molecular formula C36H50F6O9 and a molecular weight of 740.78 g/mol. Its IUPAC name is 3-O-(2-oxooxolan-3-yl) 5-O-(2-phenylpropan-2-yl) 1-O-[1,1,1-trifluoro-2-hydroxy-6-methyl-2-(trifluoromethyl)heptan-4-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(2-oxooxolan-3-yl) 5-O-(2-phenylpropan-2-yl) 1-O-[1,1,1-trifluoro-2-hydroxy-6-methyl-2-(trifluoromethyl)heptan-4-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 162701228 |
| Molecular Formula | C36H50F6O9 |
| Molecular Weight | 740.78 g/mol |
| Exact Mass | 740.34 |
| IUPAC Name | 3-O-(2-oxooxolan-3-yl) 5-O-(2-phenylpropan-2-yl) 1-O-[1,1,1-trifluoro-2-hydroxy-6-methyl-2-(trifluoromethyl)heptan-4-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC(CC(C)C)CC(O)(C(F)(F)F)C(F)(F)F)C(=O)OC1CCOC1=O)C(=O)OC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C36H50F6O9/c1-10-32(8,29(46)51-31(6,7)23-14-12-11-13-15-23)21-33(9,28(45)50-25-16-17-48-26(25)43)20-30(4,5)27(44)49-24(18-22(2)3)19-34(47,35(37,38)39)36(40,41)42/h11-15,22,24-25,47H,10,16-21H2,1-9H3 |
| InChIKey | RXEJNIRJPGBLDX-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.78 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|